2963-66-8
| Name | 2-(2-HYDROXYPHENYL)-1H-BENZIMIDAZOLE |
| CAS | 2963-66-8 |
| Molecular Formula | C13H10N2O |
| MDL Number | MFCD00022668 |
| Molecular Weight | 210.23 |
| MOL File | 2963-66-8.mol |
Chemical Properties
| Melting point | 239-243 °C |
| Boiling point | 444.2±47.0 °C(Predicted) |
| density | 1.323±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | Solubility Insoluble in water; soluble in ethanol |
| form | crystals |
| pka | 9.23(at 25℃) |
| color | White to tan |
| PH Range | Non0 uorescence (<9.9) to blue-violet 0 uorescence (9.9) |
| λmax | 245nm, 300nm |
| Major Application | Optical devices, photography, plastic scintillation applications, fungicide, antiviral agent, antiinflammatory agent, antibacterial agent |
| InChI | 1S/C13H10N2O/c16-12-8-4-1-5-9(12)13-14-10-6-2-3-7-11(10)15-13/h1-8,16H,(H,14,15) |
| InChIKey | XWXMGTIHBYFTIE-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1-c2nc3ccccc3[nH]2 |
| EPA Substance Registry System | Phenol, 2-(1H-benzimidazol-2-yl)- (2963-66-8) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |