2947-60-6
| Name | 3-Methylbenzyl cyanide |
| CAS | 2947-60-6 |
| EINECS(EC#) | 220-962-7 |
| Molecular Formula | C9H9N |
| MDL Number | MFCD00001914 |
| Molecular Weight | 131.17 |
| MOL File | 2947-60-6.mol |
Chemical Properties
| Appearance | clear colorless to light yellow liquid |
| Boiling point | 240-241 °C(lit.) |
| density | 1.002 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.002 |
| Water Solubility | INSOLUBLE |
| BRN | 1099644 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C9H9N/c1-8-3-2-4-9(7-8)5-6-10/h2-4,7H,5H2,1H3 |
| InChIKey | WOJADIOTNFDWNQ-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC=CC(C)=C1 |
| CAS DataBase Reference | 2947-60-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Tolylacetic acid nitrile(2947-60-6) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3276 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
