27876-94-4
| Name | 8,8'-DIAPOCAROTENEDIOIC ACID |
| CAS | 27876-94-4 |
| EINECS(EC#) | 248-708-0 |
| Molecular Formula | C20H24O4 |
| MDL Number | MFCD00017359 |
| Molecular Weight | 328.4 |
| MOL File | 27876-94-4.mol |
Chemical Properties
| Appearance | Red, rhomboid crystals.Soluble in pyridine and dilute sodium hydroxide; slightly soluble in water and organic solvents. Combustible. |
| Melting point | 285° |
| Boiling point | 386.14°C (rough estimate) |
| density | 1.0786 (rough estimate) |
| FEMA | 2998 |
| refractive index | 1.4434 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | 4.39±0.19(Predicted) |
| color | Red to Very Dark Red |
| Stability: | Light Sensitive |
| Cosmetics Ingredients Functions | ANTIOXIDANT COLORANT |
| InChI | InChI=1S/C20H24O4/c1-15(11-7-13-17(3)19(21)22)9-5-6-10-16(2)12-8-14-18(4)20(23)24/h5-14H,1-4H3,(H,21,22)(H,23,24)/b6-5+,11-7+,12-8+,15-9+,16-10+,17-13+,18-14+ |
| InChIKey | PANKHBYNKQNAHN-MQQNZMFNSA-N |
| SMILES | C(O)(=O)/C(/C)=C/C=C/C(/C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C(O)=O |
| LogP | 4.312 (est) |
| Uses |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P261-P264-P270-P280-P301+P312-P302+P352 |
| WGK Germany | WGK 3 |
| HS Code | 29171900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |