24964-64-5
| Name | 3-Cyanobenzaldehyde |
| CAS | 24964-64-5 |
| EINECS(EC#) | 246-549-1 |
| Molecular Formula | C8H5NO |
| MDL Number | MFCD00003344 |
| Molecular Weight | 131.13 |
| MOL File | 24964-64-5.mol |
Chemical Properties
| Appearance | white to light yellow cryst. powder or chunks |
| Melting point | 75-78 °C(lit.) |
| Boiling point | 210 °C(lit.) |
| density | 1.1971 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| Fp | 209-210°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder or Chunks |
| color | White to light yellow |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| Detection Methods | GC,NMR |
| BRN | 2205751 |
| InChI | InChI=1S/C8H5NO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,6H |
| InChIKey | HGZJJKZPPMFIBU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(C=O)=C1 |
| CAS DataBase Reference | 24964-64-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Cyanobenzaldehyde(24964-64-5) |
| Storage Precautions | Store under argon gas |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3439 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |