247089-85-6
| Name | (R)-(-)-4-Methylbezenesulfinamide |
| CAS | 247089-85-6 |
| Molecular Formula | C7H9NOS |
| MDL Number | MFCD06858374 |
| Molecular Weight | 155.22 |
| MOL File | 247089-85-6.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 115-118 °C(lit.) |
| Boiling point | 0°C |
| density | 1.28±0.1 g/cm3(Predicted) |
| Fp | 0°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.52±0.40(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C7H9NOS/c1-6-2-4-7(5-3-6)10(8)9/h2-5H,8H2,1H3 |
| InChIKey | YNJDSRPIGAUCEE-UHFFFAOYSA-N |
| SMILES | S(C1C=CC(C)=CC=1)(=O)N |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2930909899 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |