24636-31-5
| Name | 3-METHACRYLOXYPROPYLDIMETHYLCHLOROSILANE |
| CAS | 24636-31-5 |
| EINECS(EC#) | 246-377-7 |
| Molecular Formula | C9H17ClO2Si |
| MDL Number | MFCD00053899 |
| Molecular Weight | 220.77 |
| MOL File | 24636-31-5.mol |
Chemical Properties
| Boiling point | 78 °C |
| density | 1.012 g/mL at 20 °C(lit.) |
| vapor pressure | 9.6Pa at 25℃ |
| refractive index | n |
| Fp | 85°C |
| storage temp. | below 5° C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.012 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 2244691 |
| InChI | InChI=1S/C9H17ClO2Si/c1-8(2)9(11)12-6-5-7-13(3,4)10/h1,5-7H2,2-4H3 |
| InChIKey | OKQXCDUCLYWRHA-UHFFFAOYSA-N |
| SMILES | C(OCCC[Si](Cl)(C)C)(=O)C(C)=C |
| EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, 3-(chlorodimethylsilyl)propyl ester (24636-31-5) |
Safety Data
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 2931.90.9010 |
| REACH Registrations | Active |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Corr. 1A |