
2345-51-9
| Name | 3-BUTYNOIC ACID |
| CAS | 2345-51-9 |
| Molecular Formula | C4H4O2 |
| MDL Number | MFCD02258494 |
| Molecular Weight | 84.08 |
| MOL File | 2345-51-9.mol |
Chemical Properties
| Melting point | 188-195℃ |
| Boiling point | 195℃ |
| density | 1.152 |
| Fp | 83℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | powder to crystal |
| pka | 3.62±0.10(Predicted) |
| color | White to Almost white |
| λmax | 228nm(CH2Cl2)(lit.) |
| InChI | InChI=1S/C4H4O2/c1-2-3-4(5)6/h1H,3H2,(H,5,6) |
| InChIKey | KKAHGSQLSTUDAV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CC#C |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311-H314 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xn,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2923 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29161900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |

