21150-22-1
| Name | BETA-AMANITIN |
| CAS | 21150-22-1 |
| EINECS(EC#) | 244-244-8 |
| Molecular Formula | C39H53N9O15S |
| MDL Number | MFCD00151212 |
| Molecular Weight | 919.95 |
| MOL File | 21150-22-1.mol |
Chemical Properties
| Melting point | 300° |
| Boiling point | 1599.6±65.0 °C(Predicted) |
| density | 1.1725 (rough estimate) |
| refractive index | 1.7400 (estimate) |
| storage temp. | −20°C |
| solubility | Water: 1 mg/ml |
| form | White to off-white powder. |
| pka | 4.02±0.10(Predicted) |
| color | White to off-white |
| Sequence | Ile-{6-hydroxy-Trp}-Gly-Ile-Gly-Cys-Asn-Pro (Sulfidebridge try4-cys8) |
| InChIKey | IEQCUEXVAPAFMQ-UHFFFAOYSA-N |
| SMILES | CCC(C)C1NC(=O)CNC(=O)C2Cc3c([nH]c4cc(O)ccc34)S(=O)CC(NC(=O)CNC1=O)C(=O)NC(CC(O)=O)C(=O)N5CC(O)CC5C(=O)NC(C(C)C(O)CO)C(=O)N2 |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | NJ8324000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 2934999090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral |
| Toxicity |