189195-41-3
| Name | 5-METHYL-2-(TRIBUTYLSTANNYL)PYRIDINE, 96% |
| CAS | 189195-41-3 |
| Molecular Formula | C18H33NSn |
| MDL Number | MFCD07787402 |
| Molecular Weight | 382.16 |
| MOL File | 189195-41-3.mol |
Chemical Properties
| Boiling point | 130 °C(Press: 0.0038 Torr) |
| density | 1.106 g/mL at 25 °C |
| refractive index | n20/D1.514 |
| Fp | >110℃ |
| storage temp. | 2-8°C |
| solubility | Not miscible or difficult to mix. |
| form | liquid |
| pka | 5.49±0.29(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C6H6N.3C4H9.Sn/c1-6-3-2-4-7-5-6;3*1-3-4-2;/h2-3,5H,1H3;3*1,3-4H2,2H3; |
| InChIKey | MVOHAZAWWAXIDR-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(C)cn1 |
Safety Data
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2788 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |