
18881-04-4
| Name | (S)-CIS-VERBENOL |
| CAS | 18881-04-4 |
| EINECS(EC#) | 242-645-2 |
| Molecular Formula | C10H16O |
| MDL Number | MFCD00065444 |
| Molecular Weight | 152.23 |
| MOL File | 18881-04-4.mol |
Chemical Properties
| Appearance | White to pale yellow crystals |
| Melting point | 62-65 °C(lit.) |
| Boiling point | 214.9±9.0 °C(Predicted) |
| density | 1.002±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| form | Powder |
| pka | 14.56±0.60(Predicted) |
| color | Bordeaux to dark brown-red |
| Odor | at 100.00 %. balsamic |
| Odor Type | balsamic |
| Optical Rotation | [α]20/D 9° in chloroform &_& [α]20/D +10° in ethanol |
| BRN | 2206582 |
| InChI | InChI=1S/C10H16O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-9,11H,5H2,1-3H3/t7-,8+,9-/m0/s1 |
| InChIKey | WONIGEXYPVIKFS-YIZRAAEISA-N |
| SMILES | [C@]12([H])C[C@]([H])(C1(C)C)C(C)=C[C@@H]2O |
| LogP | 3.160 |
| EPA Substance Registry System | (S)-cis-Verbenol (18881-04-4) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 29061990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
