1746-81-2
| Name | MONOLINURON |
| CAS | 1746-81-2 |
| EINECS(EC#) | 217-129-5 |
| Molecular Formula | C9H11ClN2O2 |
| MDL Number | MFCD00055264 |
| Molecular Weight | 214.65 |
| MOL File | 1746-81-2.mol |
Chemical Properties
| Melting point | 81.5℃ |
| density | 1.3575 (rough estimate) |
| refractive index | 1.5790 (estimate) |
| Fp | 100 °C |
| storage temp. | 0-6°C |
| form | neat |
| pka | 12.80±0.70(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | 0.58g/L(room temperature) |
| BRN | 2212523 |
| Henry's Law Constant | 2.1×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | InChI=1S/C9H11ClN2O2/c1-12(14-2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) |
| InChIKey | LKJPSUCKSLORMF-UHFFFAOYSA-N |
| SMILES | N(OC)(C)C(NC1=CC=C(Cl)C=C1)=O |
| EPA Substance Registry System | Monolinuron (1746-81-2) |
Safety Data
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H373-H410 |
| Precautionary statements | P260-P264-P270-P273-P301+P312-P314 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | YS6425000 |
| TSCA | TSCA listed |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| Safety Profile | |
| Hazardous Substances Data | 1746-81-2(Hazardous Substances Data) |
