
172611-72-2
| Name | 2-(3-METHYLBUTYRYL)-5,5-DIMETHYL-1,3-CYCLOHEXANDIONE |
| CAS | 172611-72-2 |
| EINECS(EC#) | 218-362-5 |
| Molecular Formula | C13H20O3 |
| MDL Number | MFCD01862890 |
| Molecular Weight | 224.3 |
| MOL File | 172611-72-2.mol |
Chemical Properties
| Boiling point | 330.2±42.0 °C(Predicted) |
| density | 1.027 g/mL at 20 °C(lit.) |
| refractive index | n |
| storage temp. | Store at room temperature |
| form | clear liquid |
| pka | 4.50±1.00(Predicted) |
| color | Colorless to Light yellow to Light orange |
| BRN | 3275155 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H20O3/c1-8(2)5-9(14)12-10(15)6-13(3,4)7-11(12)16/h8,14H,5-7H2,1-4H3 |
| InChIKey | RIEWTRDZPSOAHC-UHFFFAOYSA-N |
| SMILES | C1(=O)CC(C)(C)CC(=O)/C/1=C(/O)\CC(C)C |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2914.29.5000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
