
1709-70-2
| Name | 1,3,5-Trimethyl-2,4,6-tris(3,5-di-tert-butyl-4-hydroxybenzyl)benzene |
| CAS | 1709-70-2 |
| EINECS(EC#) | 216-971-0 |
| Molecular Formula | C54H78O3 |
| MDL Number | MFCD02099205 |
| Molecular Weight | 775.2 |
| MOL File | 1709-70-2.mol |
Chemical Properties
| Appearance | Free-flowing, white, crystalline powder; no odor. Partially soluble in benzene and methylene chloride; insoluble in water. Permissible in contact with food products. Combustible. |
| Melting point | 248-250 °C(lit.) |
| Boiling point | 739.54°C (rough estimate) |
| density | 0.8883 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| Fp | 321℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Very Slightly, Heated, Sonicated) |
| form | neat |
| pka | 11.91±0.40(Predicted) |
| color | White to Off-White |
| Water Solubility | 8.09μg/L at 20℃ |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChIKey | VSAWBBYYMBQKIK-UHFFFAOYSA-N |
| SMILES | Cc1c(Cc2cc(c(O)c(c2)C(C)(C)C)C(C)(C)C)c(C)c(Cc3cc(c(O)c(c3)C(C)(C)C)C(C)(C)C)c(C)c1Cc4cc(c(O)c(c4)C(C)(C)C)C(C)(C)C |
| LogP | 17.17 |
| Uses | |
| CAS DataBase Reference | 1709-70-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1709-70-2(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| RTECS | DC3750000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 2907299000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Safety Profile | |
| Toxicity |

;