
163515-14-8
| Name | DIMETHENAMID-P |
| CAS | 163515-14-8 |
| Molecular Formula | C12H18ClNO2S |
| MDL Number | MFCD06201844 |
| Molecular Weight | 275.79 |
| MOL File | 163515-14-8.mol |
Chemical Properties
| alpha | D23 +3.5° (c = 1.102 in CH3OH) |
| Boiling point | bp9.3 Pa 122.6° |
| density | d20 1.195 |
| Fp | >150 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 1.16±0.50(Predicted) |
| color | Light Yellow to Yellow to Thick |
| Henry's Law Constant | 2.1×103 mol/(m3Pa) at 25℃, MacBean (2012) |
| Major Application | agriculture environmental |
| InChI | 1S/C12H18ClNO2S/c1-8-7-17-10(3)12(8)14(11(15)5-13)9(2)6-16-4/h7,9H,5-6H2,1-4H3/t9-/m0/s1 |
| InChIKey | JLYFCTQDENRSOL-VIFPVBQESA-N |
| SMILES | COC[C@H](C)N(C(=O)CCl)c1c(C)csc1C |
| LogP | 2.151 (est) |
| EPA Substance Registry System | Dimethenamid-P (163515-14-8) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | AB5444600 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 163515-14-8(Hazardous Substances Data) |
| Toxicity |