1498-88-0
| Name | 1,3,3-TRIMETHYLINDOLINO-6'-NITROBENZOPYRYLOSPIRAN |
| CAS | 1498-88-0 |
| EINECS(EC#) | 216-102-5 |
| Molecular Formula | C19H18N2O3 |
| MDL Number | MFCD00059175 |
| Molecular Weight | 322.36 |
| MOL File | 1498-88-0.mol |
Chemical Properties
| Melting point | 32°C |
| Boiling point | 460.98°C (rough estimate) |
| density | 1.2336 (rough estimate) |
| refractive index | 1.6140 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.41±0.40(Predicted) |
| color | Light yellow to Yellow to Green |
| λmax | 242 nm in ethanol |
| InChI | InChI=1S/C19H18N2O3/c1-18(2)15-6-4-5-7-16(15)20(3)19(18)11-10-13-12-14(21(22)23)8-9-17(13)24-19/h4-12H,1-3H3 |
| InChIKey | PSXPTGAEJZYNFI-UHFFFAOYSA-N |
| SMILES | C12(C(C)(C)C3=C(N1C)C=CC=C3)OC1=CC=C([N+]([O-])=O)C=C1C=C2 |
| EPA Substance Registry System | Spiro[2H-1-benzopyran-2,2'-[2H]indole], 1',3'-dihydro-1',3',3'-trimethyl-6-nitro- (1498-88-0) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | WG9810000 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |