144054-70-6
| Name | (S)-(-)-2-AMINO-3,3-DIMETHYL-1,1-DIPHENYL-1-BUTANOL |
| CAS | 144054-70-6 |
| Molecular Formula | C18H23NO |
| MDL Number | MFCD03427198 |
| Molecular Weight | 269.38 |
| MOL File | 144054-70-6.mol |
Chemical Properties
| Melting point | 134-137 °C(lit.) |
| Boiling point | 431.0±40.0 °C(Predicted) |
| density | 1.061±0.06 g/cm3(Predicted) |
| solubility | soluble in Acetone |
| form | powder to crystal |
| pka | 11.25±0.50(Predicted) |
| color | White to Almost white |
| Optical Rotation | [α]20/D ~ 171°, c = 1 in chloroform |
| InChI | 1S/C18H23NO/c1-17(2,3)16(19)18(20,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16,20H,19H2,1-3H3/t16-/m0/s1 |
| InChIKey | HZIHDWNOPKIOCK-INIZCTEOSA-N |
| SMILES | CC(C)(C)[C@H](N)C(O)(c1ccccc1)c2ccccc2 |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |