
143314-17-4
| Name | 1-ETHYL-3-METHYLIMIDAZOLIUM ACETATE |
| CAS | 143314-17-4 |
| EINECS(EC#) | 604-344-8 |
| Molecular Formula | C8H14N2O2 |
| MDL Number | MFCD06798186 |
| Molecular Weight | 170.21 |
| MOL File | 143314-17-4.mol |
Chemical Properties
| Melting point | -20℃ |
| density | 1.027 g/cm 3 at 25 °C |
| vapor pressure | 0-0.001Pa at 20-50℃ |
| refractive index | n20/D 1.502 |
| Fp | 164 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Light yellow to Amber to Dark green |
| Water Solubility | Soluble in water, acetonitrile, acetone, dichloromethane. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C6H11N2.C2H4O2/c1-3-8-5-4-7(2)6-8;1-2(3)4/h4-6H,3H2,1-2H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | XIYUIMLQTKODPS-UHFFFAOYSA-M |
| SMILES | [N+]1(=CN(C=C1)CC)C.C(C)(=O)[O-] |
| LogP | -2.5--2 at 23℃ and pH6.4 |
| EPA Substance Registry System | 1H-Imidazolium, 3-ethyl-1-methyl-, acetate (1:1) (143314-17-4) |
| ECW | 3.2 V |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29332900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Irrit. 2 Skin Sens. 1B |
