14167-18-1
| Name | SALCOMINE |
| CAS | 14167-18-1 |
| EINECS(EC#) | 238-012-5 |
| Molecular Formula | C16H14CoN2O2 |
| MDL Number | MFCD00000009 |
| Molecular Weight | 325.23 |
| MOL File | 14167-18-1.mol |
Chemical Properties
| Appearance | black crystalline powder |
| Melting point | >300 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | Orange to Amber to Dark red |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
| Water Solubility | Insoluble in water. Soluble in benzene, chloroform, and pyridine. |
| InChI | InChI=1S/C16H16N2O2.Co/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,19-20H,9-10H2;/q;+2/p-2/b17-11+,18-12+; |
| InChIKey | NPAQSKHBTMUERN-OYJDLGDISA-L |
| SMILES | C12=CC=CC=C1C=NCCN=CC1=CC=CC=C1O[Co]O2 |t:7,11| |
| EPA Substance Registry System | Salcomine (14167-18-1) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | GG0590000 |
| F | 10 |
| TSCA | Yes |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 14167-18-1(Hazardous Substances Data) |
| Toxicity |