138564-58-6
| Name | 2-Amino-5-methyl-3-thiophenecarbonitrile |
| CAS | 138564-58-6 |
| EINECS(EC#) | 604-082-4 |
| Molecular Formula | C6H6N2S |
| MDL Number | MFCD01626055 |
| Molecular Weight | 138.19 |
| MOL File | 138564-58-6.mol |
Chemical Properties
| Melting point | 101-103°C |
| Boiling point | 318.5±42.0 °C(Predicted) |
| density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 0.16±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C6H6N2S/c1-4-2-5(3-7)6(8)9-4/h2H,8H2,1H3 |
| InChIKey | YGXADLPRHBRTPG-UHFFFAOYSA-N |
| SMILES | C1(N)SC(C)=CC=1C#N |
| CAS DataBase Reference | 138564-58-6(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| Hazard Note | Irritant |
| REACH Registrations | Inactive |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
