137203-34-0
| Name | Bis(trimethylaluminum)-1,4-diazabicyclo[2.2.2]octane adduct |
| CAS | 137203-34-0 |
| Molecular Formula | C12H24Al2N2 |
| MDL Number | MFCD09265160 |
| Molecular Weight | 250.3 |
| MOL File | 137203-34-0.mol |
Chemical Properties
| Melting point | >250 °C |
| Fp | 23°C (73°F) |
| storage temp. | Hygroscopic, Room Temperature, Under inert atmosphere |
| solubility | Benzene (Slightly), DMSO (Slightly) |
| form | Solid |
| color | White to Off-White |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Stability: | Hygroscopic, Moisture Sensitive, Unstable in Aqueous Solution |
| InChI | 1S/C6H12N2.6CH3.2Al/c1-2-8-5-3-7(1)4-6-8;;;;;;;;/h1-6H2;6*1H3;; |
| InChIKey | WSTAITCRSVOCTK-UHFFFAOYSA-N |
| SMILES | C[Al-](C)(C)[N+]12CC[N+](CC1)(CC2)[Al-](C)(C)C |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H260-H302-H315-H319-H335 |
| Precautionary statements | P231+P232-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3395 4.3/PG 1 |
| WGK Germany | 3 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 Water-react 1 |