135544-68-2
| Name | N-(Allyloxycarbonyloxy)succinimide |
| CAS | 135544-68-2 |
| EINECS(EC#) | 677-127-9 |
| Molecular Formula | C8H9NO5 |
| MDL Number | MFCD02684388 |
| Molecular Weight | 199.16 |
| MOL File | 135544-68-2.mol |
Chemical Properties
| Melting point | 21 °C |
| Boiling point | 269.5±33.0 °C(Predicted) |
| density | 1.287 g/mL at 25 °C |
| refractive index | n20/D1.482 |
| Fp | 117℃ |
| storage temp. | 2-8°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Almost white or Almost colorless |
| InChI | InChI=1S/C8H9NO5/c1-2-5-13-8(12)14-9-6(10)3-4-7(9)11/h2H,1,3-5H2 |
| InChIKey | OIXALTPBNZNFLJ-UHFFFAOYSA-N |
| SMILES | C(OCC=C)(=O)ON1C(=O)CCC1=O |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29280000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |