131890-26-1
| Name | Bis[(2-di-i-propylphosphino]ethyl)amine, min. 97% |
| CAS | 131890-26-1 |
| Molecular Formula | C16H37NP2 |
| MDL Number | MFCD17018778 |
| Molecular Weight | 305.419 |
| MOL File | 131890-26-1.mol |
Chemical Properties
| Boiling point | 375.9±27.0 °C(Predicted) |
| density | 0.884 g/mL at 25 °C |
| Fp | -17 °C |
| refractive index | 1.4180 |
| form | liquid |
| pka | 10.42±0.19(Predicted) |
| color | pale yellow to colorless |
| Water Solubility | Immiscible with water. |
| Sensitive | Air Sensitive |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | 1S/C16H37NP2/c1-13(2)18(14(3)4)11-9-17-10-12-19(15(5)6)16(7)8/h13-17H,9-12H2,1-8H3 |
| InChIKey | FTVIGQGOGIHMBS-UHFFFAOYSA-N |
| SMILES | CC(C)P(CCNCCP(C(C)C)C(C)C)C(C)C |
Safety Data
| Hazard Codes | F,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2056 3 / PGII |
| WGK Germany | 3 |
| HS Code | 2931.39.0030 |
| HazardClass | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
;