131180-21-7
| Name | DEOXYNIVALENOL-3-GLUCOSIDE |
| CAS | 131180-21-7 |
| EINECS(EC#) | 621-635-5 |
| Molecular Formula | C21H30O11 |
| MDL Number | MFCD11114484 |
| Molecular Weight | 458.46 |
| MOL File | 131180-21-7.mol |
Chemical Properties
| Fp | 6℃ |
| storage temp. | -20°C |
| form | Liquid |
| color | Colorless to light yellow |
| BRN | 5462389 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChIKey | PUMXWMGECQIOGB-SMSDQXDJSA-N |
| SMILES | CC1=C[C@H]2O[C@@H]3[C@@H](C[C@@](C)([C@]34CO4)[C@@]2(CO)[C@H](O)C1=O)O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O |
| LogP | -2.968 (est) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P280-P305+P351+P338 |
| Hazard Codes | F,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |