121-51-7
| Name | 3-Nitrobenzenesulfonyl chloride |
| CAS | 121-51-7 |
| EINECS(EC#) | 204-476-2 |
| Molecular Formula | C6H4ClNO4S |
| MDL Number | MFCD00007435 |
| Molecular Weight | 221.62 |
| MOL File | 121-51-7.mol |
Chemical Properties
| Appearance | light beige to yellow crystalline powder |
| Melting point | 61-62 °C(lit.) |
| Boiling point | approximate 341℃ |
| density | 1.602 (estimate) |
| refractive index | 1.6000 (estimate) |
| Fp | >110°C |
| storage temp. | Store below +30°C. |
| form | Crystalline Powder |
| color | Light beige to yellow |
| Water Solubility | Decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 746542 |
| InChI | 1S/C6H4ClNO4S/c7-13(11,12)6-3-1-2-5(4-6)8(9)10/h1-4H |
| InChIKey | MWWNNNAOGWPTQY-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 121-51-7(CAS DataBase Reference) |
| NIST Chemistry Reference | M-nitrobenzene sulfonyl chloride(121-51-7) |
| Storage Precautions | Moisture sensitive |
| EPA Substance Registry System | 121-51-7(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H318-H314 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P501a-P280-P305+P351+P338-P310-P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 21 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |