1204518-02-4
| Name | (4-Methylphenyl)(2,4,6-triMethylphenyl)iodoniuM triflate |
| CAS | 1204518-02-4 |
| Molecular Formula | C17H18F3IO3S |
| MDL Number | MFCD20264882 |
| Molecular Weight | 486.288 |
| MOL File | 1204518-02-4.mol |
Chemical Properties
| Melting point | 177.0 to 182.0 °C |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Dark green |
| BRN | 20040208 |
| InChI | InChI=1S/C16H18I.CHF3O3S/c1-11-5-7-15(8-6-11)17-16-13(3)9-12(2)10-14(16)4;2-1(3,4)8(5,6)7/h5-10H,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | KVLSSMIQFXWHII-UHFFFAOYSA-M |
| SMILES | [I+](C1=CC=C(C)C=C1)C1=C(C)C=C(C)C=C1C.S(C(F)(F)F)([O-])(=O)=O |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2904.10.3700 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |