1072-53-3
| Name | ETHYLENESULFATE |
| CAS | 1072-53-3 |
| EINECS(EC#) | 600-809-4 |
| Molecular Formula | C2H4O4S |
| MDL Number | MFCD00221769 |
| Molecular Weight | 124.12 |
| MOL File | 1072-53-3.mol |
Chemical Properties
| Melting point | 95-97 °C(lit.) |
| Boiling point | 231.1±7.0℃ (760 Torr) |
| density | 1.604±0.06 g/cm3 (20 ºC 760 Torr) |
| vapor pressure | 0.91-1.7Pa at 20-25℃ |
| refractive index | 1.5090 (estimate) |
| Fp | 93.5±18.2℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | solid |
| color | White to Off-White |
| InChI | InChI=1S/C2H4O4S/c3-7(4)5-1-2-6-7/h1-2H2 |
| InChIKey | ZPFAVCIQZKRBGF-UHFFFAOYSA-N |
| SMILES | C1OS(=O)(=O)OC1 |
| LogP | -0.45 at 23℃ and pH1.4-1.7 |
| Surface tension | 66.8mN/m at 1g/L and 20℃ |
Safety Data
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H314-H317-H351 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Risk Statements | |
| WGK Germany | 3 |
| RTECS | JH4800000 |
| REACH Registrations | Active |
| HS Code | 29209085 |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1B |
