
1019-45-0
| Name | N,N-Dimethyl-5-methoxytryptamine |
| CAS | 1019-45-0 |
| EINECS(EC#) | 213-813-2 |
| Molecular Formula | C13H18N2O |
| MDL Number | MFCD00005658 |
| Molecular Weight | 218.29 |
| MOL File | 1019-45-0.mol |
Chemical Properties
| Appearance | off-white to slightly yellow crystalline powder |
| Melting point | 69 °C |
| Boiling point | 358.99°C (rough estimate) |
| density | 1.0346 (rough estimate) |
| refractive index | 1.6450 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 16.94±0.30(Predicted) |
| color | Pale Beige |
| Water Solubility | PRACTICALLY INSOLUBLE |
| Major Application | forensics and toxicology |
| InChI | 1S/C13H18N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3 |
| InChIKey | ZSTKHSQDNIGFLM-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CNC2=CC=C(OC)C=C21 |
| CAS DataBase Reference | 1019-45-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-Indole-3-ethanamine, 5-methoxy-N,N-dimethyl-(1019-45-0) |
Safety Data
| Hazard Codes | C,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | WGK 2 |
| RTECS | NL7380000 |
| HS Code | 29339980 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |