101803-03-6
| Name | N2-ETHYL-2'-DEOXYGUANOSINE |
| CAS | 101803-03-6 |
| Molecular Formula | C12H17N5O4 |
| MDL Number | MFCD01631004 |
| Molecular Weight | 295.29 |
| MOL File | 101803-03-6.mol |
Chemical Properties
| Melting point | 240-242 °C (decomp) |
| density | 1.764±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | 2-8°C |
| solubility | H2O: >5mg/mL |
| form | solid |
| pka | 10.620±0.10(predicted) |
| color | white to off-white |
| Water Solubility | H2O: >5mg/mL |
| InChI | 1S/C12H17N5O4/c1-2-13-12-15-10-9(11(20)16-12)14-5-17(10)8-3-6(19)7(4-18)21-8/h5-8,18-19H,2-4H2,1H3,(H2,13,15,16,20)/t6-,7+,8+/m0/s1 |
| InChIKey | VOKQFDULHQUWAV-XLPZGREQSA-N |
| SMILES | CCNC1=Nc2c(ncn2[C@H]3C[C@H](O)[C@@H](CO)O3)C(=O)N1 |
Safety Data
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGI |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Carc. 2 STOT RE 2 |