
101555-63-9
| Name | FMOC-D-PIPECOLIC ACID |
| CAS | 101555-63-9 |
| Molecular Formula | C21H21NO4 |
| MDL Number | MFCD00235899 |
| Molecular Weight | 351.4 |
| MOL File | 101555-63-9.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 149-153°C |
| Boiling point | 561.6±43.0 °C(Predicted) |
| density | 1.293±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | Solid |
| pka | 3.97±0.20(Predicted) |
| color | White to pale brown |
| Optical Rotation | 20.768°(C=0.01g/ml DMF) |
| BRN | 5485101 |
| Major Application | peptide synthesis |
| InChI | 1S/C21H21NO4/c23-20(24)19-11-5-6-12-22(19)21(25)26-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18/h1-4,7-10,18-19H,5-6,11-13H2,(H,23,24)/t19-/m1/s1 |
| InChIKey | CKLAZLINARHOTG-LJQANCHMSA-N |
| SMILES | OC(=O)[C@H]1CCCCN1C(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 101555-63-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3077 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
