101219-68-5
| Name | (R)-1-(4-FLUOROPHENYL)ETHANOL |
| CAS | 101219-68-5 |
| Molecular Formula | C8H9FO |
| MDL Number | MFCD03092997 |
| Molecular Weight | 140.15 |
| MOL File | 101219-68-5.mol |
Chemical Properties
| Appearance | clear colorless to pale yellow liquid |
| alpha | 50 º (C=1 IN CHLOROFORM) |
| Boiling point | 90-92 °C/7 mmHg |
| density | 1.111 g/mL at 25 °C |
| refractive index | n20/D 1.502 |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 14.36±0.20(Predicted) |
| color | Clear colorless to pale yellow |
| Optical Rotation | [α]20/D +50°, c = 1 in chloroform |
| InChI | InChI=1/C8H9FO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/s3 |
| InChIKey | PSDSORRYQPTKSV-ISZMHOAENA-N |
| SMILES | C1(=CC=C(F)C=C1)[C@H](O)C |&1:7,r| |
| CAS DataBase Reference | 101219-68-5 |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29062990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |