10121-91-2
| Name | DANSYLCADAVERINE |
| CAS | 10121-91-2 |
| EINECS(EC#) | 233-326-9 |
| Molecular Formula | C17H25N3O2S |
| MDL Number | MFCD00042704 |
| Molecular Weight | 335.46 |
| MOL File | 10121-91-2.mol |
Chemical Properties
| Melting point | 137-140 °C |
| Boiling point | 505.5±60.0 °C(Predicted) |
| density | 1.190±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Do you have solubility information on this product that you would like to share |
| form | powder |
| pka | 11.96±0.50(Predicted) |
| color | Yellow to yellowish green |
| Appearance | Solid Powder |
| λmax | 335 nm |
| BRN | 2951070 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or methanol may be stored at -20°C for up to 1 month. |
| Biological Applications | Measuring cardiac autophagic flux; treating cataract,fibrosis,Parkinson’s disease,peritoneal ovarian tumor dissemination,respiratory diseases,lung diseases,Huntington’s disease,spinobulbar atrophy,spinocerebellar ataxia,denta |
| InChI | 1S/C17H25N3O2S/c1-20(2)16-10-6-9-15-14(16)8-7-11-17(15)23(21,22)19-13-5-3-4-12-18/h6-11,19H,3-5,12-13,18H2,1-2H3 |
| InChIKey | MLEBFEHOJICQQS-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(cccc12)S(=O)(=O)NCCCCCN |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-23 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |