100849-37-4
| Name | ANILINE (13C6) |
| CAS | 100849-37-4 |
| Molecular Formula | C6H7N |
| MDL Number | MFCD00143617 |
| Molecular Weight | 99.18 |
| MOL File | 100849-37-4.mol |
Chemical Properties
| Melting point | -6 °C (lit.) |
| Boiling point | 184 °C (lit.) |
| density | 1.087 g/mL at 25 °C |
| refractive index | n |
| Fp | 158 °F |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2) (1:4): 0.2 mg/ml |
| form | A neat oil |
| Stability: | Air sensitive, Material Darkens In Storage With No Loss In Purity, Material dark |
| InChI | 1S/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | PAYRUJLWNCNPSJ-IDEBNGHGSA-N |
| SMILES | N[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| CAS Number Unlabeled | 62-53-3 |
Safety Data
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1547 6.1/PG 2 |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Dam. 1 Muta. 2 Skin Sens. 1 STOT RE 1 |