6-Фтор-4-(трифторметил)-2(1H)-хинолинон
- английское имя6-Fluoro-4-(trifluoromethyl)-2(1H)-quinolinone
- CAS №328956-08-7
- CBNumberCB92128695
- ФормулаC10H5F4NO
- мольный вес231.15
- номер MDLMFCD17015723
- файл Mol328956-08-7.mol
химическое свойство
| Температура плавления | 252-253 °C (decomp)(Solv: ethanol (64-17-5)) |
| Температура кипения | 282 ºC |
| плотность | 1.468 |
| Fp | 124 ºC |
| температура хранения | 2-8°C |
| пка | 9.33±0.70(Predicted) |
| InChI | InChI=1S/C10H5F4NO/c11-5-1-2-8-6(3-5)7(10(12,13)14)4-9(16)15-8/h1-4H,(H,15,16) |
| ИнЧИКей | WUFRBOSKPZUGIS-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(F)C=C2)C(C(F)(F)F)=CC1=O |
| Заявления о рисках | 36/37/38 |
| Заявления о безопасности | 26-36/37/39 |
| кода HS | 29334900 |
6-Фтор-4-(трифторметил)-2(1H)-хинолинон химические свойства, назначение, производство
Химические свойства
White solidОписание
As a quinoline derivative, 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline is substituted with trifluoromethyl, hydroxyl, and fluoride groups. In particular, 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline can exist in a tautomeric form, known as quinolone, where the hydroxy group becomes a ketone and the imine changes to an amine. This compound is a precursor for synthesizing thioquinolines, which are used to develop non-cytotoxic, potent and selective antitubercular agents. The thiolation reaction is carried out using phosphorus pentasulfide in pyridine.6-Фтор-4-(трифторметил)-2(1H)-хинолинон запасные части и сырье
сырьё
запасной предмет
6-Фтор-4-(трифторметил)-2(1H)-хинолинон поставщик
| поставщик | телефон | страна | номенклатура продукции | благоприятные условия | |
|---|---|---|---|---|---|
| +undefined18915499068 | China | 120 | 58 | ||
| +86-0371-86658258 +8613203830695 |
China | 29871 | 58 | ||
| +86 519 86305871 | CHINA | 4241 | 58 | ||
| +86-023-6139-8061 +86-86-13650506873 |
China | 39894 | 58 | ||
| +8618523575427 | China | 49732 | 58 | ||
| +86-0519-85551759 +8613506123987 |
China | 8840 | 58 | ||
| +86-0551-65418684 +8618949823763 |
China | 25356 | 58 | ||
| +8613776644403 | China | 1804 | 58 | ||
| +1-817863-6948 +1-（817）863-6948 |
United States | 19632 | 58 | ||
| +1-+1(833)-552-7181 | United States | 52924 | 58 |