Squalene
- русский язык имя
- английское имяSqualene
- CAS №7683-64-9
- CBNumberCB5332287
- ФормулаC30H50
- мольный вес410.72
- EINECS203-826-1
- номер MDLMFCD00008912
- файл Mol7683-64-9.mol
химическое свойство
| Температура плавления | −75 °C(lit.) |
| Температура кипения | 285 °C25 mm Hg(lit.) |
| плотность | 0.858 g/mL at 25 °C(lit.) |
| показатель преломления | n |
| Fp | >230 °F |
| температура хранения | Sealed in dry,2-8°C |
| растворимость | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| форма | liquid |
| цвет | light yellow |
| InChI | InChI=1S/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3 |
| ИнЧИКей | YYGNTYWPHWGJRM-UHFFFAOYSA-N |
| SMILES | C/C(/C)=C\CCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CC/C=C(/C)\C |
| LogP | 12.188 (est) |
| Рейтинг продуктов питания EWG | 1 |
| FDA UNII | 7QWM220FJH |
| Справочник по химии NIST | Squalene(7683-64-9) |
| Система регистрации веществ EPA | Spinacene (7683-64-9) |
| Информация о косметике | Squalene |
| UNSPSC Code | 12352211 |
больше
Squalene химические свойства, назначение, производство
Использование
squalene is like squalane, squalene replenishes skin lipids while softening and smoothing. It helps maintain the skin in good condition. When used in hair care products, it serves as a hairconditioning and anti-static agent.Определение
squalene: An intermediate compoundformed in the synthesis ofcholesterol; it is a hydrocarbon containing30 carbon atoms. The immediateoxidation of squalene tosqualene 2,3-epoxide is the last commonstep in the synthesis of sterolsin animals, plants, and fungi.Squalene запасные части и сырье
запасной предмет
Squalene поставщик
| поставщик | телефон | страна | номенклатура продукции | благоприятные условия |
|---|---|---|---|---|
| +8615531157085 | China | 8804 | 58 | |
| +86-029-81138252 +86-18789408387 |
China | 3889 | 58 | |
| +86-29-81148696 +86-15536356810 |
China | 3882 | 58 | |
| +86 13288715578 +8613288715578 |
China | 12825 | 58 | |
| +8617531153977 | China | 5855 | 58 | |
| +86-13131129325 | China | 5887 | 58 | |
| +8617732866630 | China | 18147 | 58 | |
| +undefined17712220823 | China | 615 | 58 | |
| +86-371-86557731 +86-13613820652 |
China | 20259 | 58 | |
| +86-18400010335 +86-18034520335 |
China | 1015 | 58 |