Mc-Val-Cit-PABC-PNP
- русский язык имя
- английское имяMc-Val-Cit-PABC-PNP
- CAS №159857-81-5
- CBNumberCB32667895
- ФормулаC35H43N7O11
- мольный вес737.76
- номер MDLMFCD22200431
- файл Mol159857-81-5.mol
химическое свойство
| Температура кипения | 1034.5±65.0 °C(Predicted) |
| плотность | 1.338±0.06 g/cm3(Predicted) |
| температура хранения | under inert gas (nitrogen or Argon) at 2-8°C |
| растворимость | DMF: 25 mg/ml; DMSO: 20 mg/ml; DMSO:PBS(pH 7.2) (1:4): 0.20 mg/ml |
| форма | A crystalline solid |
| пка | 13.24±0.70(Predicted) |
| цвет | Off-white to light yellow |
| ИнЧИКей | UQRQGHMQKAXOTE-DHIFEGFHSA-N |
| SMILES | C(N)(=O)[C@H](CCCNC(N)=O)N(C(=O)[C@H](C(C)C)NC(=O)CCCCCN1C(=O)C=CC1=O)C1=CC=C(COC(OC2=CC=C([N+]([O-])=O)C=C2)=O)C=C1 |
| FDA UNII | QY7B3AFP6T |
| UNSPSC Code | 12352200 |
| NACRES | NA.22 |
Mc-Val-Cit-PABC-PNP химические свойства, назначение, производство
Описание
Mc-Val-Cit-PABC-PNP is a peptide linker molecule used in the synthesis of antibody-drug conjugates (ADCs). It contains a maleimidocaproyl (Mc) group that can be conjugated to an antibody and a p-nitrophenol (PNP) group that allows the peptide to be linked to anticancer compounds, such as doxorubicin or monomethyl auristatin E (MMAE; ). ADCs target specific cell populations to induce a selective response, such as cell death in cancer cells.Использование
Mc-Val-Cit-PABC-PNP is a cathepsin cleavable ADC linker used in the synthesis of antibody-drug conjugates.Общее описание
Mc-Val-Cit-PABC-PNP is chemically known as L-OrnithinaMide, N-[6-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxohexyl]-L-valyl-N5-(aMinocarbonyl)-N-[4-[[[(4-nitrophenoxy)carbonyl]oxy]Methyl]phenyl]-, an enzymatically cleavable linker for antibody-drug conjugates (ADCs). Other ADCs linkers include MC-Val-Cit-PAB-PNP, Mc-Val-Ala-PAB-PNP, Mc-Val-Cit-PABOH, and VcMMAE.Mc-Val-Cit-PABC-PNP запасные части и сырье
Mc-Val-Cit-PABC-PNP поставщик
| поставщик | телефон | страна | номенклатура продукции | благоприятные условия | |
|---|---|---|---|---|---|
| +86-021-58950125 +86-021-58950125; |
China | 780 | 58 | ||
| +86-371-86557731 +86-13613820652 |
China | 20259 | 58 | ||
| +undefined-21-51877795 | China | 32965 | 60 | ||
| 323-480-4688 | United States | 989 | 55 | ||
| 0086-13720134139 | CHINA | 965 | 58 | ||
| +86-755-89396905 +86-15013857715 |
China | 10453 | 58 | ||
| +8615866703830 | China | 8497 | 58 | ||
| +1-858-6993322 | United States | 18526 | 58 | ||
| +1-631-485-4226 | United States | 19553 | 58 | ||
| 00852-68527855 | China Hong Kong | 902 | 58 |