![ChemicalBook](https://m.chemicalbook.com/Scripts/New/img/logo.png)
![структурированное изображение](/CAS/20210111/GIF/1649454-57-8.gif)
5-Bromo-4-cyclopropyl-6-methoxypyrimidine
- русский язык имя
- английское имя5-Bromo-4-cyclopropyl-6-methoxypyrimidine
- CAS №1649454-57-8
- CBNumberCB23617757
- ФормулаC8H9BrN2O
- мольный вес229.07
- номер MDLMFCD31556944
- файл Mol1649454-57-8.mol
химическое свойство
Температура кипения | 289.3±40.0 °C(Predicted) |
плотность | 1.590±0.06 g/cm3(Predicted) |
пка | 2.13±0.28(Predicted) |
InChI | InChI=1S/C8H9BrN2O/c1-12-8-6(9)7(5-2-3-5)10-4-11-8/h4-5H,2-3H2,1H3 |
ИнЧИКей | FHEYKQYHQQAZBJ-UHFFFAOYSA-N |
SMILES | C1=NC(OC)=C(Br)C(C2CC2)=N1 |
5-Bromo-4-cyclopropyl-6-methoxypyrimidine химические свойства, назначение, производство
Синтез
To a solution of 4-cyclopropyl-6-methoxypyrimidine (1.6 g, 10.7 mmol) in EtOH (10 mL) was added Bn (1.87 g, 11.7 mmol) at -20 °C. The resulting mixture was slowly warmed to room temperature and stirred at the same temperature for 16 h. Solvent was removed under reduced pressure and the residue dissolved in EtOAc and washed with saturated Na2C03, water and brine. The organic layer was dried over Na2SO4 and concentrated to give 5-bromo-4-cyclopropyl-6-methoxypyrimidine (2.3 g).![5-Bromo-4-cyclopropyl-6-methoxypyrimidine 5-Bromo-4-cyclopropyl-6-methoxypyrimidine](/NewsImg/2023-11-07/6383496105067712073705978.jpg)
5-Bromo-4-cyclopropyl-6-methoxypyrimidine поставщик
поставщик | телефон | страна | номенклатура продукции | благоприятные условия |
---|---|---|---|---|
+8615866703830 | China | 7621 | 58 | |
+1-858-6993322 | United States | 19447 | 58 | |
+86-27-50766799 +8618062016861 |
China | 19994 | 58 | |
+86-057181025280; +8617767106207 |
China | 49739 | 58 | |
+undefined15865876430 | China | 146 | 58 | |
+8615896017193 | China | 217 | 58 | |
+86-852-30606658 | China | 43348 | 58 | |
+8618235132063 | China | 3741 | 58 | |
+1-+1(833)-552-7181 | United States | 52927 | 58 | |
+8618168183658 | China | 39009 | 58 |