2,6-Bis(hydroxymethyl)-p-cresol
- Product Name2,6-Bis(hydroxymethyl)-p-cresol
- CAS91-04-3
- MFC9H12O3
- MW168.19
- EINECS202-036-4
- MOL File91-04-3.mol
Chemical Properties
| Melting point | 128-130 °C(lit.) |
| Boiling point | 237.12°C (rough estimate) |
| Density | 1.0812 (rough estimate) |
| vapor density | 5.8 (vs air) |
| refractive index | 1.4371 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | very faint turbidity in THF |
| form | powder to crystal |
| pka | 10.20±0.23(Predicted) |
| color | White to Yellow to Orange |
| BRN | 1240237 |
| InChI | InChI=1S/C9H12O3/c1-6-2-7(4-10)9(12)8(3-6)5-11/h2-3,10-12H,4-5H2,1H3 |
| InChIKey | KUMMBDBTERQYCG-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC(C)=CC(CO)=C1O |
| CAS DataBase Reference | 91-04-3(CAS DataBase Reference) |
| NIST Chemistry Reference | A1,a3-mesityllenediol, 2-hydroxy-(91-04-3) |
| EPA Substance Registry System | 1,3-Benzenedimethanol, 2-hydroxy-5-methyl- (91-04-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | CZ6440000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |