4-Amino-5-aminomethyl-2-methylpyrimidine
- Product Name4-Amino-5-aminomethyl-2-methylpyrimidine
- CAS95-02-3
- MFC6H10N4
- MW138.17
- EINECS202-384-7
- MOL File95-02-3.mol
Chemical Properties
| Melting point | 270-272°C |
| Boiling point | 121-125 °C |
| Density | 1.207 |
| vapor pressure | 0.012-0.019Pa at 20-25℃ |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly) |
| form | Solid |
| pka | 7.70±0.29(Predicted) |
| color | Off-White to Beige |
| PH | 10.65 at 20℃ and 10g/L |
| InChI | InChI=1S/C6H10N4/c1-4-9-3-5(2-7)6(8)10-4/h3H,2,7H2,1H3,(H2,8,9,10) |
| InChIKey | OZOHTVFCSKFMLL-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=C(CN)C(N)=N1 |
| LogP | -2.27 at 20℃ and pH7 |
| Surface tension | 72.77mN/m at 1g/L and 20℃ |