2-Chloro-4-nitropyridine 1-oxide
- Product Name2-Chloro-4-nitropyridine 1-oxide
- CAS14432-16-7
- MFC5H3ClN2O3
- MW174.54
- EINECS238-404-6
- MOL File14432-16-7.mol
Chemical Properties
| Melting point | 151-155 °C (lit.) |
| Boiling point | 405.9±25.0 °C(Predicted) |
| Density | 1.62±0.1 g/cm3(Predicted) |
| Flash point | 223 °F |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | powder to crystal |
| pka | -2.53±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| BRN | 145697 |
| InChI | 1S/C5H3ClN2O3/c6-5-3-4(8(10)11)1-2-7(5)9/h1-3H |
| InChIKey | YSTCMHHKDOVZDA-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc[n+]([O-])c(Cl)c1 |
| CAS DataBase Reference | 14432-16-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36-45-36/37/39-28 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
