![1-[[2,4,6-Tris(isopropyl)phenyl]sulphonyl]-1H-1,2,4-triazole Structure](/CAS/GIF/54230-60-3.gif)
1-[[2,4,6-Tris(isopropyl)phenyl]sulphonyl]-1H-1,2,4-triazole
- Product Name1-[[2,4,6-Tris(isopropyl)phenyl]sulphonyl]-1H-1,2,4-triazole
- CAS54230-60-3
- MFC17H25N3O2S
- MW335.46
- EINECS259-035-7
- MOL File54230-60-3.mol
Chemical Properties
| Melting point | 111-114 °C |
| Boiling point | 451.9±55.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| pka | -1.13±0.11(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C17H25N3O2S/c1-11(2)14-7-15(12(3)4)17(16(8-14)13(5)6)23(21,22)20-10-18-9-19-20/h7-13H,1-6H3 |
| InChIKey | BKJMMUUBRUWPPQ-UHFFFAOYSA-N |
| SMILES | N1(S(C2=C(C(C)C)C=C(C(C)C)C=C2C(C)C)(=O)=O)C=NC=N1 |
| CAS DataBase Reference | 54230-60-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29339900 |
![1-[[2,4,6-Tris(isopropyl)phenyl]sulphonyl]-1H-1,2,4-triazole pictures](/ProductImageEN/2022-09/Small/d3a033eb-b31e-4e47-887c-625254e64763.png)
![1-[[2,4,6-Tris(isopropyl)phenyl]sulphonyl]-1H-1,2,4-triazole pictures](/ProductImageEN/2021-07/Small/f40c83bf-aa11-4a8d-9c2c-8ca09466c1e5.jpg)
![1-[[2,4,6-Tris(isopropyl)phenyl]sulphonyl]-1H-1,2,4-triazole pictures](/ProductImageEN/2021-07/Small/3d3989b9-7707-4b16-b948-1841c0613a5b.jpg)