3,4-Difluorobenzotrifluoride
- Product Name3,4-Difluorobenzotrifluoride
- CAS32137-19-2
- MFC7H3F5
- MW182.09
- EINECS608-708-7
- MOL File32137-19-2.mol
Chemical Properties
| Melting point | 95-98 °C |
| Boiling point | 103-104 °C |
| Density | 1.41 |
| refractive index | 1.388-1.392 |
| Flash point | 103-104°C |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| BRN | 1950149 |
| InChI | InChI=1S/C7H3F5/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H |
| InChIKey | MVCGQTYWLZSKSB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(C(F)(F)F)C=C1F |
| CAS DataBase Reference | 32137-19-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi-F,F,Xi |
| Risk Statements | 36/37/38-11 |
| Safety Statements | 37/39-26-16-36 |
| RIDADR | 1993 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
