Pyridine-4-carboxylic acid N-oxide
- Product NamePyridine-4-carboxylic acid N-oxide
- CAS13602-12-5
- MFC6H5NO3
- MW139.11
- EINECS237-086-6
- MOL File13602-12-5.mol
Chemical Properties
| Melting point | 270-271 °C(lit.) |
| Boiling point | 255.04°C (rough estimate) |
| Density | 1.4429 (rough estimate) |
| refractive index | 1.5423 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.66±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light red |
| BRN | 119571 |
| InChI | InChI=1S/C6H5NO3/c8-6(9)5-1-3-7(10)4-2-5/h1-4H,(H,8,9) |
| InChIKey | QCWTWMJMLSKQCJ-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=C(C(O)=O)C=1 |
| LogP | -1.520 (est) |
| CAS DataBase Reference | 13602-12-5(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Pyridinecarboxylic acid 1-oxide (13602-12-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
