α-Chloralose
- Product Nameα-Chloralose
- CAS15879-93-3
- MFC8H11Cl3O6
- MW309.53
- EINECS240-016-7
- MOL File15879-93-3.mol
Chemical Properties
| Melting point | 178-182 °C |
| alpha | 18 º (c=2, 95% C2H5OH) |
| Boiling point | 424.33°C (rough estimate) |
| Density | 1.6066 (rough estimate) |
| vapor pressure | Negligible at room temperature |
| refractive index | 1.5320 (estimate) |
| solubility | ethanol: 10 mg/mL or yellow-brown, clear to slightly hazy, colorless to faintly yellow |
| pka | 12.89±0.60(Predicted) |
| form | Solid |
| color | White to Almost white |
| optical activity | [α]20/D +17±2°, 5 hr, c = 2% in ethanol |
| Water Solubility | 0.44 g/100 mL (15 ºC) |
| Merck | 14,2072 |
| BRN | 85418 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H11Cl3O6/c9-8(10,11)7-16-5-3(14)4(2(13)1-12)15-6(5)17-7/h2-7,12-14H,1H2/t2-,3+,4-,5-,6-,7-/m1/s1 |
| InChIKey | OJYGBLRPYBAHRT-IPQSZEQASA-N |
| SMILES | OC[C@@H](O)[C@H]1O[C@@H]2O[C@@H](O[C@@H]2[C@H]1O)C(Cl)(Cl)Cl |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/22-20/21/22 |
| Safety Statements | 16-24/25-28-28A-36 |
| RIDADR | 3249 |
| WGK Germany | 1 |
| RTECS | FM9450000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29400090 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Inhalation Aquatic Acute 1 Aquatic Chronic 1 STOT SE 3 |
| Toxicity | LD50 orally in mice: 400 mg/kg (Schafer) |
