2-Bromophenylhydrazine hydrochloride
- Product Name2-Bromophenylhydrazine hydrochloride
- CAS50709-33-6
- MFC6H8BrClN2
- MW223.5
- EINECS256-728-6
- MOL File50709-33-6.mol
Chemical Properties
| Melting point | 189 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Sensitive | Hygroscopic |
| BRN | 3628612 |
| InChI | InChI=1S/C6H7BrN2.ClH/c7-5-3-1-2-4-6(5)9-8;/h1-4,9H,8H2;1H |
| InChIKey | PHCYUJRYSFMJMG-UHFFFAOYSA-N |
| SMILES | C1(NN)=CC=CC=C1Br.Cl |
| CAS DataBase Reference | 50709-33-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xn |
| Risk Statements | 34-20/21-31-20 |
| Safety Statements | 26-27-36/37/39-45-23 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| PackingGroup | Ⅱ |
| HS Code | 29280000 |
