3-Bromo-2-fluorotoluene
- Product Name3-Bromo-2-fluorotoluene
- CAS59907-12-9
- MFC7H6BrF
- MW189.03
- EINECS261-981-0
- MOL File59907-12-9.mol
Chemical Properties
| Boiling point | 186 °C |
| Density | 1.52 |
| refractive index | n20/D 1.533 |
| Flash point | 76°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C7H6BrF/c1-5-3-2-4-6(8)7(5)9/h2-4H,1H3 |
| InChIKey | LZVNGSFAHGKCDM-UHFFFAOYSA-N |
| SMILES | C1(C(F)=C(C)C=CC=1)Br |
| CAS DataBase Reference | 59907-12-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |