1H-Benzotriazol-1-yloxytris(dimethylamino)phosphonium Hexafluorophosphate
- Product Name1H-Benzotriazol-1-yloxytris(dimethylamino)phosphonium Hexafluorophosphate
- CAS56602-33-6
- MFC12H22F6N6OP2
- MW442.29
- EINECS260-279-1
- MOL File56602-33-6.mol
Chemical Properties
| Melting point | >130 °C (dec.)(lit.) |
| Flash point | 138°C |
| storage temp. | 2-8°C |
| solubility | methanol: 25 mg/mL, clear |
| form | Powder |
| color | White to off-white |
| Water Solubility | Soluble in methanol, acetone and dichloromethane. Insoluble in water. |
| Sensitive | Moisture & Light Sensitive |
| Decomposition | 138 ºC |
| BRN | 4287025 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C12H22N6OP.F6P/c1-15(2)20(16(3)4,17(5)6)19-18-12-10-8-7-9-11(12)13-14-18;1-7(2,3,4,5)6/h7-10H,1-6H3;/q+1;-1 |
| InChIKey | MGEVGECQZUIPSV-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[P+](N(C)C)(N(C)C)(N(C)C)ON1N=NC2C=CC=CC1=2 |
| CAS DataBase Reference | 56602-33-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,E,F |
| Risk Statements | 37/38-44-36/37/38-11-2 |
| Safety Statements | 24/25-37/39-36-26-35-36/37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10-21 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | Ⅱ |
| HS Code | 29339980 |
| Storage Class | 4.1A - Other explosive hazardous materials |
| Hazard Classifications | Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |
