Chemical Properties
| Melting point | 247-249 °C(lit.) |
| Boiling point | 442.26°C (rough estimate) |
| Density | 1.276 |
| refractive index | 1.4570 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | methanol: 100 mg/mL, clear |
| pka | 1.14±0.19(Predicted) |
| form | Powder |
| color | Yellow |
| Odor | Odorless |
| Merck | 14,9750 |
| BRN | 282581 |
| InChI | InChI=1S/C18H12N6/c1-4-10-19-13(7-1)16-22-17(14-8-2-5-11-20-14)24-18(23-16)15-9-3-6-12-21-15/h1-12H |
| InChIKey | KMVWNDHKTPHDMT-UHFFFAOYSA-N |
| SMILES | N1=C(C2=NC=CC=C2)N=C(C2=NC=CC=C2)N=C1C1=NC=CC=C1 |
| EPA Substance Registry System | 1,3,5-Triazine, 2,4,6-tri-2-pyridinyl- (3682-35-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | XZ2050000 |
| TSCA | Yes |
| HS Code | 29336990 |
| Toxicity | bird - wild,LD50,oral,5620ug/kg (5.62mg/kg),Archives of Environmental Contamination and Toxicology. Vol. 12, Pg. 355, 1983. |
