| Melting point |
111-115 °C(lit.) |
| Boiling point |
180 °C / 15mmHg |
| Density |
1.320±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
powder to crystal |
| pka |
8.68±0.19(Predicted) |
| color |
Light yellow to Brown |
| InChI |
InChI=1S/C7H7NO3/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,9H,1H3 |
| InChIKey |
UMFDLIXUUJMPSI-UHFFFAOYSA-N |
| SMILES |
C1(O)=CC([N+]([O-])=O)=CC=C1C |
| CAS DataBase Reference |
5428-54-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-Methyl-5-nitrophenol(5428-54-6) |
| EPA Substance Registry System |
Phenol, 2-methyl-5-nitro- (5428-54-6) |
