2-Chloro-5-methyl-3-nitropyridine
- Product Name2-Chloro-5-methyl-3-nitropyridine
- CAS23056-40-8
- MFC6H5ClN2O2
- MW172.57
- EINECS624-905-0
- MOL File23056-40-8.mol
Chemical Properties
| Melting point | 45-50 °C |
| Boiling point | 290.8±35.0 °C(Predicted) |
| Density | 1.406±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -2.20±0.10(Predicted) |
| color | White to Orange to Green |
| Sensitive | Hygroscopic |
| BRN | 138198 |
| InChI | 1S/C6H5ClN2O2/c1-4-2-5(9(10)11)6(7)8-3-4/h2-3H,1H3 |
| InChIKey | LUAJUWOJEFFNFE-UHFFFAOYSA-N |
| SMILES | Cc1cnc(Cl)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 23056-40-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-21/22-41-37/38-22 |
| Safety Statements | 36/37/39-26-36-39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |