3-Ethoxy-4-methoxybenzaldehyde
- Product Name3-Ethoxy-4-methoxybenzaldehyde
- CAS1131-52-8
- MFC10H12O3
- MW180.2
- EINECS642-869-4
- MOL File1131-52-8.mol
Chemical Properties
| Melting point | 51 °C |
| Boiling point | 155°C/10mmHg(lit.) |
| Density | 1.088±0.06 g/cm3(Predicted) |
| Flash point | 113 °C |
| storage temp. | room temp |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| color | White to Orange to Green |
| Sensitive | Air Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C10H12O3/c1-3-13-10-6-8(7-11)4-5-9(10)12-2/h4-7H,3H2,1-2H3 |
| InChIKey | VAMZHXWLGRQSJS-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OC)C(OCC)=C1 |
| CAS DataBase Reference | 1131-52-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29124990 |
| Storage Class | 11 - Combustible Solids |
